191-07-1 Coronene
| Nome del prodotto |
Coronene |
| Nome inglese |
Coronene; Hexabenzobenzene; Coronene (purity) |
| Formula molecolare |
C24H12 |
| Peso Molecolare |
300.3521 |
| InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| Numero CAS |
191-07-1 |
| EINECS |
205-881-7 |
| Struttura molecolare |
|
| Densità |
1.467g/cm3 |
| Punto di fusione |
438-440℃ |
| Punto di ebollizione |
525.6°C at 760 mmHg |
| Indice di rifrazione |
2.139 |
| Punto d'infiammabilità |
265.2°C |
| Pressione di vapore |
1.3E-10mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|