191-07-1 Coronene
| Nama produk |
Coronene |
| Nama Inggeris |
Coronene; Hexabenzobenzene; Coronene (purity) |
| MF |
C24H12 |
| Berat Molekul |
300.3521 |
| InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| CAS NO |
191-07-1 |
| EINECS |
205-881-7 |
| Struktur Molekul |
|
| Kepadatan |
1.467g/cm3 |
| Titik lebur |
438-440℃ |
| Titik didih |
525.6°C at 760 mmHg |
| Indeks bias |
2.139 |
| Titik nyala |
265.2°C |
| Tekanan wap |
1.3E-10mmHg at 25°C |
| Cinta bahaya |
Xn:Harmful;
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|