191-07-1 Coronene
| Nazwa produktu: |
Coronene |
| Angielska nazwa |
Coronene; Hexabenzobenzene; Coronene (purity) |
| MF |
C24H12 |
| Masie cz?steczkowej |
300.3521 |
| InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
| Nr CAS |
191-07-1 |
| EINECS |
205-881-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.467g/cm3 |
| Temperatura topnienia |
438-440℃ |
| Temperatura wrzenia |
525.6°C at 760 mmHg |
| Wspó?czynnik za?amania |
2.139 |
| Temperatura zap?onu |
265.2°C |
| Ci?nienie pary |
1.3E-10mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|