ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
| Nama produk |
N-(3-Chlorophenyl)urethane |
| Sinonim |
; Ethyl 3-chlorocarbanilate ~ Ethyl N-(3-chlorophenyl) carbamate; etil (3-chlorophenyl)carbamate |
| Nama Inggeris |
N-(3-Chlorophenyl)urethane; Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| MF |
C9H10ClNO2 |
| Berat Molekul |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS NO |
2150-89-2 |
| Struktur Molekul |
|
| Kepadatan |
1.268g/cm3 |
| Titik didih |
238.5°C at 760 mmHg |
| Indeks bias |
1.572 |
| Titik nyala |
98°C |
| Tekanan wap |
0.0424mmHg at 25°C |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|