2150-89-2 N-(3-Klorofenil)üretan
| ürün Ad? |
N-(3-Klorofenil)üretan |
| E? anlaml? |
Etil 3-klorokarbanilat ~ Etil N- (3-klorofenil) karbamat; etil (3-klorofenil)karbamat;
|
| ingilizce ad? |
N-(3-Chlorophenyl)urethane; Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Moleküler Formülü |
C9H10ClNO2 |
| Molekül A??rl??? |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS kay?t numaras? |
2150-89-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.268g/cm3 |
| Kaynama noktas? |
238.5°C at 760 mmHg |
| K?r?lma indisi |
1.572 |
| Alevlenme noktas? |
98°C |
| Buhar bas?nc? |
0.0424mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|