2150-89-2 N-(3-klorfenyl)uretan
| produktnavn |
N-(3-klorfenyl)uretan |
| Synonymer |
; Etyl 3-klorkarbanilat ~ etyl N-(3-klorfenyl) karbamat; etyl (3-klorfenyl)karbamat |
| Engelsk navn |
N-(3-Chlorophenyl)urethane; Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Molekyl?r Formel |
C9H10ClNO2 |
| Molekylvekt |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS-nummer |
2150-89-2 |
| Molecular Structure |
|
| Tetthet |
1.268g/cm3 |
| Kokepunkt |
238.5°C at 760 mmHg |
| Brytningsindeks |
1.572 |
| Flammepunktet |
98°C |
| Damptrykk |
0.0424mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|