2150-89-2 N-(3-clorofenil)uretano
| Nome do produto |
N-(3-clorofenil)uretano |
| Sin?nimos |
3-clorocarbbanilato de etila~Etil N-(3-clorofenil) carbamato; etil(3-clorofenil)carbamato |
| Nome em inglês |
N-(3-Chlorophenyl)urethane; Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Fórmula molecular |
C9H10ClNO2 |
| Peso Molecular |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| CAS Registry Number |
2150-89-2 |
| Estrutura Molecular |
|
| Densidade |
1.268g/cm3 |
| Ponto de ebuli??o |
238.5°C at 760 mmHg |
| índice de refra??o |
1.572 |
| O ponto de inflama??o |
98°C |
| Press?o de vapor |
0.0424mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|