ChemNet > CAS > 2150-89-2 N-(3-Chlorophenyl)urethane
2150-89-2 N-(3-Chlorophenyl)urethane
| product Name |
N-(3-Chlorophenyl)urethane |
| CAS No |
2150-89-2 |
| Synonyms |
Ethyl 3-chlorocarbanilate~Ethyl N-(3-chlorophenyl) carbamate; ethyl (3-chlorophenyl)carbamate |
| Molecular Formula |
C9H10ClNO2 |
| Molecular Weight |
199.6342 |
| InChI |
InChI=1/C9H10ClNO2/c1-2-13-9(12)11-8-5-3-4-7(10)6-8/h3-6H,2H2,1H3,(H,11,12) |
| Molecular Structure |
|
| Density |
1.268g/cm3 |
| Boiling point |
238.5°C at 760 mmHg |
| Refractive index |
1.572 |
| Flash point |
98°C |
| Vapour Pressur |
0.0424mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr Huang |
| Telephone |
+86-571-86066502;18958062155 |
| Email |
sales@shuypharm.com |
| Address |
No. 590, Wenyi West Road, Hangzhou, Zhejiang, China |