636-26-0 5-methyl-2-thiouracil
| ürün Ad? |
5-methyl-2-thiouracil |
| ingilizce ad? |
5-methyl-2-thiouracil; 4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| Moleküler Formülü |
C5H6N2OS |
| Molekül A??rl??? |
142.1789 |
| InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| CAS kay?t numaras? |
636-26-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.36g/cm3 |
| Ergime noktas? |
265-267℃ |
| Kaynama noktas? |
329.7°C at 760 mmHg |
| K?r?lma indisi |
1.638 |
| Alevlenme noktas? |
153.2°C |
| Buhar bas?nc? |
9.11E-05mmHg at 25°C |
| Risk Kodlar? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|