636-26-0 5-methyl-2-thiouracil
| Nama produk |
5-methyl-2-thiouracil |
| Nama Inggeris |
5-methyl-2-thiouracil; 4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| MF |
C5H6N2OS |
| Berat Molekul |
142.1789 |
| InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| CAS NO |
636-26-0 |
| Struktur Molekul |
|
| Kepadatan |
1.36g/cm3 |
| Titik lebur |
265-267℃ |
| Titik didih |
329.7°C at 760 mmHg |
| Indeks bias |
1.638 |
| Titik nyala |
153.2°C |
| Tekanan wap |
9.11E-05mmHg at 25°C |
| Kod Risiko |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|