636-26-0 5-methyl-2-thiouracil
| Ονομασ?α του προ??ντο? |
5-methyl-2-thiouracil |
| Αγγλικ? ?νομα |
5-methyl-2-thiouracil; 4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| MF |
C5H6N2OS |
| Μοριακ? β?ρο? |
142.1789 |
| InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| CAS ΟΧΙ |
636-26-0 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.36g/cm3 |
| Σημε?ο τ?ξη? |
265-267℃ |
| Σημε?ο βρασμο? |
329.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.638 |
| Σημε?ο αν?φλεξη? |
153.2°C |
| Π?εση ατμ?ν |
9.11E-05mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|