636-26-0 5-methyl-2-thiouracil
| Nome do produto |
5-methyl-2-thiouracil |
| Nome em inglês |
5-methyl-2-thiouracil; 4-Hydroxy-2-mercapto-5-methylpyrimidine; 2-Thiothymine; 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one |
| Fórmula molecular |
C5H6N2OS |
| Peso Molecular |
142.1789 |
| InChI |
InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9) |
| CAS Registry Number |
636-26-0 |
| Estrutura Molecular |
|
| Densidade |
1.36g/cm3 |
| Ponto de fus?o |
265-267℃ |
| Ponto de ebuli??o |
329.7°C at 760 mmHg |
| índice de refra??o |
1.638 |
| O ponto de inflama??o |
153.2°C |
| Press?o de vapor |
9.11E-05mmHg at 25°C |
| Códigos de risco |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|