627-90-7 ethyl undecanoate
| ürün Ad? |
ethyl undecanoate |
| ingilizce ad? |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
| Moleküler Formülü |
C13H26O2 |
| Molekül A??rl??? |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
| CAS kay?t numaras? |
627-90-7 |
| EINECS |
211-018-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.869g/cm3 |
| Ergime noktas? |
-15℃ |
| Kaynama noktas? |
258.4°C at 760 mmHg |
| K?r?lma indisi |
1.432 |
| Alevlenme noktas? |
109.5°C |
| Buhar bas?nc? |
0.0137mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|