627-90-7 ethyl undecanoate
| Nome do produto |
ethyl undecanoate |
| Nome em inglês |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
| Fórmula molecular |
C13H26O2 |
| Peso Molecular |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
| CAS Registry Number |
627-90-7 |
| EINECS |
211-018-5 |
| Estrutura Molecular |
|
| Densidade |
0.869g/cm3 |
| Ponto de fus?o |
-15℃ |
| Ponto de ebuli??o |
258.4°C at 760 mmHg |
| índice de refra??o |
1.432 |
| O ponto de inflama??o |
109.5°C |
| Press?o de vapor |
0.0137mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|