627-90-7 ethyl undecanoate
| Nome del prodotto |
ethyl undecanoate |
| Nome inglese |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
| Formula molecolare |
C13H26O2 |
| Peso Molecolare |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
| Numero CAS |
627-90-7 |
| EINECS |
211-018-5 |
| Struttura molecolare |
|
| Densità |
0.869g/cm3 |
| Punto di fusione |
-15℃ |
| Punto di ebollizione |
258.4°C at 760 mmHg |
| Indice di rifrazione |
1.432 |
| Punto d'infiammabilità |
109.5°C |
| Pressione di vapore |
0.0137mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|