627-90-7 ethyl undecanoate
| produktnavn |
ethyl undecanoate |
| Engelsk navn |
ethyl undecanoate; Undecanoic acid ethyl ester; Undecanoic acid-ethyl ester |
| Molekyl?r Formel |
C13H26O2 |
| Molekylvekt |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-3-5-6-7-8-9-10-11-12-13(14)15-4-2/h3-12H2,1-2H3 |
| CAS-nummer |
627-90-7 |
| EINECS |
211-018-5 |
| Molecular Structure |
|
| Tetthet |
0.869g/cm3 |
| Smeltepunkt |
-15℃ |
| Kokepunkt |
258.4°C at 760 mmHg |
| Brytningsindeks |
1.432 |
| Flammepunktet |
109.5°C |
| Damptrykk |
0.0137mmHg at 25°C |
| Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|