621-51-2 3-Ethoxybenzoic acid
| ürün Ad? |
3-Ethoxybenzoic acid |
| ingilizce ad? |
3-Ethoxybenzoic acid; 3-Ethoxy Benzoic Acid |
| Moleküler Formülü |
C9H10O3 |
| Molekül A??rl??? |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| CAS kay?t numaras? |
621-51-2 |
| EINECS |
210-690-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.166g/cm3 |
| Ergime noktas? |
136-140℃ |
| Kaynama noktas? |
305.7°C at 760 mmHg |
| K?r?lma indisi |
1.537 |
| Alevlenme noktas? |
124.1°C |
| Buhar bas?nc? |
0.000354mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|