621-51-2 3-Ethoxybenzoic acid
| ?????? ?? ??? |
3-Ethoxybenzoic acid |
| ???????? ??? |
3-Ethoxybenzoic acid; 3-Ethoxy Benzoic Acid |
| ????? ???????? |
C9H10O3 |
| ?????? ??? |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| ??? ??????? ?????? |
621-51-2 |
| EINECS |
210-690-7 |
| ????? ?????? |
|
| ????? |
1.166g/cm3 |
| ?????? |
136-140℃ |
| ????? ?? ??? |
305.7°C at 760 mmHg |
| ??????? ??????? |
1.537 |
| ????? ??????? |
124.1°C |
| ????? ?? ???? |
0.000354mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|