621-51-2 3-Ethoxybenzoic acid
| termék neve |
3-Ethoxybenzoic acid |
| Angol név |
3-Ethoxybenzoic acid; 3-Ethoxy Benzoic Acid |
| MF |
C9H10O3 |
| Molekulat?meg |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| CAS-szám |
621-51-2 |
| EINECS |
210-690-7 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.166g/cm3 |
| Olvadáspont |
136-140℃ |
| Forráspont |
305.7°C at 760 mmHg |
| T?résmutató |
1.537 |
| Gyulladáspont |
124.1°C |
| G?znyomás |
0.000354mmHg at 25°C |
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|