621-51-2 3-Ethoxybenzoic acid
| Ονομασ?α του προ??ντο? |
3-Ethoxybenzoic acid |
| Αγγλικ? ?νομα |
3-Ethoxybenzoic acid; 3-Ethoxy Benzoic Acid |
| MF |
C9H10O3 |
| Μοριακ? β?ρο? |
166.1739 |
| InChI |
InChI=1/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| CAS ΟΧΙ |
621-51-2 |
| EINECS |
210-690-7 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.166g/cm3 |
| Σημε?ο τ?ξη? |
136-140℃ |
| Σημε?ο βρασμο? |
305.7°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.537 |
| Σημε?ο αν?φλεξη? |
124.1°C |
| Π?εση ατμ?ν |
0.000354mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|