ChemNet > CAS > 392-22-3 2-Chloro-6-fluorocinnamic acid
392-22-3 2-Chloro-6-fluorocinnamic acid
| ürün Ad? |
2-Chloro-6-fluorocinnamic acid |
| ingilizce ad? |
2-Chloro-6-fluorocinnamic acid; 3-(2-Chloro-6-fluorophenyl)acrylic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate; (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid |
| Moleküler Formülü |
C9H6ClFO2 |
| Molekül A??rl??? |
200.5941 |
| InChI |
InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4- |
| CAS kay?t numaras? |
392-22-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.42g/cm3 |
| Kaynama noktas? |
312.8°C at 760 mmHg |
| K?r?lma indisi |
1.604 |
| Alevlenme noktas? |
143°C |
| Buhar bas?nc? |
0.00022mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|