ChemNet > CAS > 392-22-3 2-Chloro-6-fluorocinnamic acid
392-22-3 2-Chloro-6-fluorocinnamic acid
| ?????? ?? ??? |
2-Chloro-6-fluorocinnamic acid |
| ???????? ??? |
2-Chloro-6-fluorocinnamic acid; 3-(2-Chloro-6-fluorophenyl)acrylic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate; (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid |
| ????? ???????? |
C9H6ClFO2 |
| ?????? ??? |
200.5941 |
| InChI |
InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4- |
| ??? ??????? ?????? |
392-22-3 |
| ????? ?????? |
|
| ????? |
1.42g/cm3 |
| ????? ?? ??? |
312.8°C at 760 mmHg |
| ??????? ??????? |
1.604 |
| ????? ??????? |
143°C |
| ????? ?? ???? |
0.00022mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|