ChemNet > CAS > 392-22-3 2-Chloro-6-fluorocinnamic acid
392-22-3 2-Chloro-6-fluorocinnamic acid
| Nazwa produktu: |
2-Chloro-6-fluorocinnamic acid |
| Angielska nazwa |
2-Chloro-6-fluorocinnamic acid; 3-(2-Chloro-6-fluorophenyl)acrylic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate; (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid |
| MF |
C9H6ClFO2 |
| Masie cz?steczkowej |
200.5941 |
| InChI |
InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4- |
| Nr CAS |
392-22-3 |
| Struktury molekularnej |
|
| G?sto?? |
1.42g/cm3 |
| Temperatura wrzenia |
312.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.604 |
| Temperatura zap?onu |
143°C |
| Ci?nienie pary |
0.00022mmHg at 25°C |
| Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|