ChemNet > CAS > 392-22-3 2-Chloro-6-fluorocinnamic acid
392-22-3 2-Chloro-6-fluorocinnamic acid
| Nome do produto |
2-Chloro-6-fluorocinnamic acid |
| Nome em inglês |
2-Chloro-6-fluorocinnamic acid; 3-(2-Chloro-6-fluorophenyl)acrylic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid; (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate; (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid |
| Fórmula molecular |
C9H6ClFO2 |
| Peso Molecular |
200.5941 |
| InChI |
InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4- |
| CAS Registry Number |
392-22-3 |
| Estrutura Molecular |
|
| Densidade |
1.42g/cm3 |
| Ponto de ebuli??o |
312.8°C at 760 mmHg |
| índice de refra??o |
1.604 |
| O ponto de inflama??o |
143°C |
| Press?o de vapor |
0.00022mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|