2562-38-1 nitrocyclopentane
| ürün Ad? |
nitrocyclopentane |
| ingilizce ad? |
nitrocyclopentane;Cyclopentane, nitro-; CCRIS 5057; Nitrocyclopentane; Nitrocyclopentase |
| Moleküler Formülü |
C5H9NO2 |
| Molekül A??rl??? |
115.1305 |
| InChI |
InChI=1/C5H9NO2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2 |
| CAS kay?t numaras? |
2562-38-1 |
| EINECS |
219-884-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.09g/cm3 |
| Kaynama noktas? |
181.1°C at 760 mmHg |
| K?r?lma indisi |
1.464 |
| Alevlenme noktas? |
71.4°C |
| Buhar bas?nc? |
0.866mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|