2562-38-1 nitrocyclopentane
| Nome do produto |
nitrocyclopentane |
| Nome em inglês |
nitrocyclopentane;Cyclopentane, nitro-; CCRIS 5057; Nitrocyclopentane; Nitrocyclopentase |
| Fórmula molecular |
C5H9NO2 |
| Peso Molecular |
115.1305 |
| InChI |
InChI=1/C5H9NO2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2 |
| CAS Registry Number |
2562-38-1 |
| EINECS |
219-884-6 |
| Estrutura Molecular |
|
| Densidade |
1.09g/cm3 |
| Ponto de ebuli??o |
181.1°C at 760 mmHg |
| índice de refra??o |
1.464 |
| O ponto de inflama??o |
71.4°C |
| Press?o de vapor |
0.866mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|