2562-38-1 nitrocyclopentane
| Nama produk |
nitrocyclopentane |
| Nama Inggeris |
nitrocyclopentane;Cyclopentane, nitro-; CCRIS 5057; Nitrocyclopentane; Nitrocyclopentase |
| MF |
C5H9NO2 |
| Berat Molekul |
115.1305 |
| InChI |
InChI=1/C5H9NO2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2 |
| CAS NO |
2562-38-1 |
| EINECS |
219-884-6 |
| Struktur Molekul |
|
| Kepadatan |
1.09g/cm3 |
| Titik didih |
181.1°C at 760 mmHg |
| Indeks bias |
1.464 |
| Titik nyala |
71.4°C |
| Tekanan wap |
0.866mmHg at 25°C |
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|