2562-38-1 nitrocyclopentane
| Naam product |
nitrocyclopentane |
| Engelse naam |
nitrocyclopentane;Cyclopentane, nitro-; CCRIS 5057; Nitrocyclopentane; Nitrocyclopentase |
| MF |
C5H9NO2 |
| Molecuulgewicht |
115.1305 |
| InChI |
InChI=1/C5H9NO2/c7-6(8)5-3-1-2-4-5/h5H,1-4H2 |
| CAS-nummer |
2562-38-1 |
| EINECS |
219-884-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.09g/cm3 |
| Kookpunt |
181.1°C at 760 mmHg |
| Brekingsindex |
1.464 |
| Vlampunt |
71.4°C |
| Dampdruk |
0.866mmHg at 25°C |
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|