ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| ürün Ad? |
3,4-Dimethoxybenzonitrile |
| ingilizce ad? |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
| Moleküler Formülü |
C9H9NO2 |
| Molekül A??rl??? |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| CAS kay?t numaras? |
2024-83-1 |
| EINECS |
217-969-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.12g/cm3 |
| Ergime noktas? |
66-71℃ |
| Kaynama noktas? |
266.2°C at 760 mmHg |
| K?r?lma indisi |
1.519 |
| Alevlenme noktas? |
107.5°C |
| Buhar bas?nc? |
0.00877mmHg at 25°C |
| Tehlike Sembolleri |
Xn:Harmful;
|
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
|
|