ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| Nome del prodotto |
3,4-Dimethoxybenzonitrile |
| Nome inglese |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
| Formula molecolare |
C9H9NO2 |
| Peso Molecolare |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| Numero CAS |
2024-83-1 |
| EINECS |
217-969-2 |
| Struttura molecolare |
|
| Densità |
1.12g/cm3 |
| Punto di fusione |
66-71℃ |
| Punto di ebollizione |
266.2°C at 760 mmHg |
| Indice di rifrazione |
1.519 |
| Punto d'infiammabilità |
107.5°C |
| Pressione di vapore |
0.00877mmHg at 25°C |
| Simboli di pericolo |
Xn:Harmful;
|
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|