ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| product Name |
3,4-Dimethoxybenzonitrile |
| CAS No |
2024-83-1 |
| Synonyms |
Veratronitrile; 3,4-Dimethoybenzonitrile |
| Molecular Formula |
C9H9NO2 |
| Molecular Weight |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| EINECS |
217-969-2 |
| Molecular Structure |
|
| Density |
1.12g/cm3 |
| Melting point |
66-71℃ |
| Boiling point |
266.2°C at 760 mmHg |
| Refractive index |
1.519 |
| Flash point |
107.5°C |
| Vapour Pressur |
0.00877mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |
| Contact |
Sergei Gresko |
| Telephone |
+380623854830 |
| Email |
sales@intermedchemicals.com |
| Address |
17-a Bakinsky Kommissarov Str. 83049 Donetsk UKRAINE |