ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| Nazwa produktu: |
3,4-Dimethoxybenzonitrile |
| Angielska nazwa |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
| MF |
C9H9NO2 |
| Masie cz?steczkowej |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| Nr CAS |
2024-83-1 |
| EINECS |
217-969-2 |
| Struktury molekularnej |
|
| G?sto?? |
1.12g/cm3 |
| Temperatura topnienia |
66-71℃ |
| Temperatura wrzenia |
266.2°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.519 |
| Temperatura zap?onu |
107.5°C |
| Ci?nienie pary |
0.00877mmHg at 25°C |
| Symbole zagro?enia |
Xn:Harmful;
|
| Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|