ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
| ürün Ad? |
Dimethyl 3-nitrophthalate |
| ingilizce ad? |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| Moleküler Formülü |
C10H9NO6 |
| Molekül A??rl??? |
239.1816 |
| InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| CAS kay?t numaras? |
13365-26-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.35g/cm3 |
| Kaynama noktas? |
314.6°C at 760 mmHg |
| K?r?lma indisi |
1.549 |
| Alevlenme noktas? |
134.3°C |
| Buhar bas?nc? |
0.000462mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|