ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
| Nome do produto |
Dimethyl 3-nitrophthalate |
| Nome em inglês |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| Fórmula molecular |
C10H9NO6 |
| Peso Molecular |
239.1816 |
| InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| CAS Registry Number |
13365-26-9 |
| Estrutura Molecular |
|
| Densidade |
1.35g/cm3 |
| Ponto de ebuli??o |
314.6°C at 760 mmHg |
| índice de refra??o |
1.549 |
| O ponto de inflama??o |
134.3°C |
| Press?o de vapor |
0.000462mmHg at 25°C |
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|