ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
| Nome del prodotto |
Dimethyl 3-nitrophthalate |
| Nome inglese |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| Formula molecolare |
C10H9NO6 |
| Peso Molecolare |
239.1816 |
| InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| Numero CAS |
13365-26-9 |
| Struttura molecolare |
|
| Densità |
1.35g/cm3 |
| Punto di ebollizione |
314.6°C at 760 mmHg |
| Indice di rifrazione |
1.549 |
| Punto d'infiammabilità |
134.3°C |
| Pressione di vapore |
0.000462mmHg at 25°C |
| Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|