ChemNet > CAS > 13365-26-9 Dimethyl 3-nitrophthalate
13365-26-9 Dimethyl 3-nitrophthalate
| Nazwa produktu: |
Dimethyl 3-nitrophthalate |
| Angielska nazwa |
Dimethyl 3-nitrophthalate; 3-Nitrophthalic acid dimethyl ester; dimethyl 3-nitrobenzene-1,2-dicarboxylate |
| MF |
C10H9NO6 |
| Masie cz?steczkowej |
239.1816 |
| InChI |
InChI=1/C10H9NO6/c1-16-9(12)6-4-3-5-7(11(14)15)8(6)10(13)17-2/h3-5H,1-2H3 |
| Nr CAS |
13365-26-9 |
| Struktury molekularnej |
|
| G?sto?? |
1.35g/cm3 |
| Temperatura wrzenia |
314.6°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.549 |
| Temperatura zap?onu |
134.3°C |
| Ci?nienie pary |
0.000462mmHg at 25°C |
| Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|