102-38-5 3-Nitroformanilide
| ürün Ad? |
3-Nitroformanilide |
| ingilizce ad? |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| Moleküler Formülü |
C7H6N2O3 |
| Molekül A??rl??? |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| CAS kay?t numaras? |
102-38-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.407g/cm3 |
| Kaynama noktas? |
368.5°C at 760 mmHg |
| K?r?lma indisi |
1.641 |
| Alevlenme noktas? |
176.7°C |
| Buhar bas?nc? |
1.27E-05mmHg at 25°C |
| Risk Kodlar? |
R20/22:Harmful by inhalation and if swallowed.;
|
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|