102-38-5 3-Nitroformanilide
| Nome do produto |
3-Nitroformanilide |
| Nome em inglês |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| Fórmula molecular |
C7H6N2O3 |
| Peso Molecular |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| CAS Registry Number |
102-38-5 |
| Estrutura Molecular |
|
| Densidade |
1.407g/cm3 |
| Ponto de ebuli??o |
368.5°C at 760 mmHg |
| índice de refra??o |
1.641 |
| O ponto de inflama??o |
176.7°C |
| Press?o de vapor |
1.27E-05mmHg at 25°C |
| Códigos de risco |
R20/22:Harmful by inhalation and if swallowed.;
|
| Descri??o da Seguran?a |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|