102-38-5 3-Nitroformanilide
| Nom |
3-Nitroformanilide |
| Nom anglais |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| Formule moléculaire |
C7H6N2O3 |
| Poids Moléculaire |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| Numéro de registre CAS |
102-38-5 |
| Structure moléculaire |
|
| Densité |
1.407g/cm3 |
| Point d'ébullition |
368.5°C at 760 mmHg |
| Indice de réfraction |
1.641 |
| Point d'éclair |
176.7°C |
| Pression de vapeur |
1.27E-05mmHg at 25°C |
| Codes des risques |
R20/22:Harmful by inhalation and if swallowed.;
|
| Description de sécurité |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|