102-38-5 3-Nitroformanilide
| Ονομασ?α του προ??ντο? |
3-Nitroformanilide |
| Αγγλικ? ?νομα |
3-Nitroformanilide;N-(3-nitrophenyl)formamide |
| MF |
C7H6N2O3 |
| Μοριακ? β?ρο? |
166.1341 |
| InChI |
InChI=1/C7H6N2O3/c10-5-8-6-2-1-3-7(4-6)9(11)12/h1-5H,(H,8,10) |
| CAS ΟΧΙ |
102-38-5 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.407g/cm3 |
| Σημε?ο βρασμο? |
368.5°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.641 |
| Σημε?ο αν?φλεξη? |
176.7°C |
| Π?εση ατμ?ν |
1.27E-05mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R20/22:Harmful by inhalation and if swallowed.;
|
| Περιγραφ? τη? ασφ?λεια? |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|