6214-44-4 4-Ethoxybenzyl alcohol
| Nome do produto |
4-Ethoxybenzyl alcohol |
| Nome em inglês |
4-Ethoxybenzyl alcohol; AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| Fórmula molecular |
C9H12O2 |
| Peso Molecular |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| CAS Registry Number |
6214-44-4 |
| EINECS |
228-283-8 |
| Estrutura Molecular |
|
| Densidade |
1.058g/cm3 |
| Ponto de fus?o |
27-32℃ |
| Ponto de ebuli??o |
273°C at 760 mmHg |
| índice de refra??o |
1.524 |
| O ponto de inflama??o |
114.4°C |
| Press?o de vapor |
0.00287mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|