6214-44-4 4-Ethoxybenzyl alcohol
| Produkt-Name |
4-Ethoxybenzyl alcohol |
| Englischer Name |
4-Ethoxybenzyl alcohol; AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| Molekulare Formel |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| CAS Registry Number |
6214-44-4 |
| EINECS |
228-283-8 |
| Molecular Structure |
|
| Dichte |
1.058g/cm3 |
| Schmelzpunkt |
27-32℃ |
| Siedepunkt |
273°C at 760 mmHg |
| Brechungsindex |
1.524 |
| Flammpunkt |
114.4°C |
| Dampfdruck |
0.00287mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|