6214-44-4 4-Ethoxybenzyl alcohol
| product Name |
4-Ethoxybenzyl alcohol |
| CAS No |
6214-44-4 |
| Synonyms |
AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| Molecular Formula |
C9H12O2 |
| Molecular Weight |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| EINECS |
228-283-8 |
| Molecular Structure |
|
| Density |
1.058g/cm3 |
| Melting point |
27-32℃ |
| Boiling point |
273°C at 760 mmHg |
| Refractive index |
1.524 |
| Flash point |
114.4°C |
| Vapour Pressur |
0.00287mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Contact |
Mr Zhou |
| Telephone |
+86-18961205066 |
| Email |
sales@globalhongdachem.com |
| Address |
Wujin, Changzhou City, Jiangsu, China |
| Contact |
Jason Jing |
| Telephone |
+86-571-85586718 |
| Email |
sales@capot.com |
| Address |
Wanlun Sci Park,No.88 Jiangling RD,Hangzhou, Zhejiang, China, 310051 |
| Contact |
Mr Chen Wei-dong |
| Telephone |
+86-21-64251386 |
| Email |
wdchen@shwychem.com |
| Address |
HQ in Shanghai: 4st Floor S&T Industry Building, 130 Meilong Road, Shanghai200237,China |