6214-44-4 4-Ethoxybenzyl alcohol
| Naam product |
4-Ethoxybenzyl alcohol |
| Engelse naam |
4-Ethoxybenzyl alcohol; AI3-05517; Benzenemethanol, 4-ethoxy-; (4-ethoxyphenyl)methanol |
| MF |
C9H12O2 |
| Molecuulgewicht |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6,10H,2,7H2,1H3 |
| CAS-nummer |
6214-44-4 |
| EINECS |
228-283-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.058g/cm3 |
| Smeltpunt |
27-32℃ |
| Kookpunt |
273°C at 760 mmHg |
| Brekingsindex |
1.524 |
| Vlampunt |
114.4°C |
| Dampdruk |
0.00287mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|