606-27-9 Methyl 2-nitrobenzoate
| Nome do produto |
Methyl 2-nitrobenzoate |
| Nome em inglês |
Methyl 2-nitrobenzoate; 2-Nitrobenzoic acid methyl ester |
| Fórmula molecular |
C8H7NO4 |
| Peso Molecular |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| CAS Registry Number |
606-27-9 |
| EINECS |
210-111-8 |
| Estrutura Molecular |
|
| Densidade |
1.301g/cm3 |
| Ponto de fus?o |
-13℃ |
| Ponto de ebuli??o |
275°C at 760 mmHg |
| índice de refra??o |
1.553 |
| O ponto de inflama??o |
124.8°C |
| Press?o de vapor |
0.00523mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|