606-27-9 Methyl 2-nitrobenzoate
| Naam product |
Methyl 2-nitrobenzoate |
| Engelse naam |
Methyl 2-nitrobenzoate; 2-Nitrobenzoic acid methyl ester |
| MF |
C8H7NO4 |
| Molecuulgewicht |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| CAS-nummer |
606-27-9 |
| EINECS |
210-111-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.301g/cm3 |
| Smeltpunt |
-13℃ |
| Kookpunt |
275°C at 760 mmHg |
| Brekingsindex |
1.553 |
| Vlampunt |
124.8°C |
| Dampdruk |
0.00523mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|