606-27-9 Methyl 2-nitrobenzoate
| product Name |
Methyl 2-nitrobenzoate |
| CAS No |
606-27-9 |
| Synonyms |
2-Nitrobenzoic acid methyl ester |
| Molecular Formula |
C8H7NO4 |
| Molecular Weight |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| EINECS |
210-111-8 |
| Molecular Structure |
|
| Density |
1.301g/cm3 |
| Melting point |
-13℃ |
| Boiling point |
275°C at 760 mmHg |
| Refractive index |
1.553 |
| Flash point |
124.8°C |
| Vapour Pressur |
0.00523mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|