606-27-9 Methyl 2-nitrobenzoate
| Nome del prodotto |
Methyl 2-nitrobenzoate |
| Nome inglese |
Methyl 2-nitrobenzoate; 2-Nitrobenzoic acid methyl ester |
| Formula molecolare |
C8H7NO4 |
| Peso Molecolare |
181.1455 |
| InChI |
InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
| Numero CAS |
606-27-9 |
| EINECS |
210-111-8 |
| Struttura molecolare |
|
| Densità |
1.301g/cm3 |
| Punto di fusione |
-13℃ |
| Punto di ebollizione |
275°C at 760 mmHg |
| Indice di rifrazione |
1.553 |
| Punto d'infiammabilità |
124.8°C |
| Pressione di vapore |
0.00523mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|