112-17-4 decyl acetate
| Nome do produto |
decyl acetate |
| Nome em inglês |
decyl acetate; N-DECYL ACETATE |
| Fórmula molecular |
C12H24O2 |
| Peso Molecular |
200.3178 |
| InChI |
InChI=1/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
| CAS Registry Number |
112-17-4 |
| EINECS |
203-942-2 |
| Estrutura Molecular |
|
| Densidade |
0.87g/cm3 |
| Ponto de ebuli??o |
244.1°C at 760 mmHg |
| índice de refra??o |
1.429 |
| O ponto de inflama??o |
101.3°C |
| Press?o de vapor |
0.031mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|