112-17-4 decyl acetate
| Produkt-Name |
decyl acetate |
| Englischer Name |
decyl acetate; N-DECYL ACETATE |
| Molekulare Formel |
C12H24O2 |
| Molecular Weight |
200.3178 |
| InChI |
InChI=1/C12H24O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-11H2,1-2H3 |
| CAS Registry Number |
112-17-4 |
| EINECS |
203-942-2 |
| Molecular Structure |
|
| Dichte |
0.87g/cm3 |
| Siedepunkt |
244.1°C at 760 mmHg |
| Brechungsindex |
1.429 |
| Flammpunkt |
101.3°C |
| Dampfdruck |
0.031mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|